C23H39NO6 — CID 164593088
methyl 4-[2-[2-[6-[3-[(1S)-1-aminoethyl]phenoxy]hexoxy]ethoxy]ethoxy]butanoate (PubChem CID 164593088) has the molecular formula C23H39NO6 and a molecular weight of 425.57 g/mol. Its IUPAC name is methyl 4-[2-[2-[6-[3-[(1S)-1-aminoethyl]phenoxy]hexoxy]ethoxy]ethoxy]butanoate.
| Compound Name | methyl 4-[2-[2-[6-[3-[(1S)-1-aminoethyl]phenoxy]hexoxy]ethoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 164593088 |
| Molecular Formula | C23H39NO6 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | methyl 4-[2-[2-[6-[3-[(1S)-1-aminoethyl]phenoxy]hexoxy]ethoxy]ethoxy]butanoate |
| SMILES | COC(=O)CCCOCCOCCOCCCCCCOc1cccc([C@H](C)N)c1 |
| InChI | InChI=1S/C23H39NO6/c1-20(24)21-9-7-10-22(19-21)30-14-6-4-3-5-12-27-15-17-29-18-16-28-13-8-11-23(25)26-2/h7,9-10,19-20H,3-6,8,11-18,24H2,1-2H3/t20-/m0/s1 |
| InChIKey | JKKHKMHXHPYTJL-FQEVSTJZSA-N |
| XLogP | 3.65 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|