C24H42ClNO6 — CID 164592528
6-[2-[2-[6-[3-[(1R)-1-aminoethyl]phenoxy]hexoxy]ethoxy]ethoxy]hexanoic acid;hydrochloride (PubChem CID 164592528) has the molecular formula C24H42ClNO6 and a molecular weight of 476.05 g/mol. Its IUPAC name is 6-[2-[2-[6-[3-[(1R)-1-aminoethyl]phenoxy]hexoxy]ethoxy]ethoxy]hexanoic acid;hydrochloride.
| Compound Name | 6-[2-[2-[6-[3-[(1R)-1-aminoethyl]phenoxy]hexoxy]ethoxy]ethoxy]hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 164592528 |
| Molecular Formula | C24H42ClNO6 |
| Molecular Weight | 476.05 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 6-[2-[2-[6-[3-[(1R)-1-aminoethyl]phenoxy]hexoxy]ethoxy]ethoxy]hexanoic acid;hydrochloride |
| SMILES | C[C@@H](N)c1cccc(OCCCCCCOCCOCCOCCCCCC(=O)O)c1.Cl |
| InChI | InChI=1S/C24H41NO6.ClH/c1-21(25)22-10-9-11-23(20-22)31-15-8-3-2-6-13-28-16-18-30-19-17-29-14-7-4-5-12-24(26)27;/h9-11,20-21H,2-8,12-19,25H2,1H3,(H,26,27);1H/t21-;/m1./s1 |
| InChIKey | NCSTVOJKAYAIIZ-ZMBIFBSDSA-N |
| XLogP | 4.76 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.05 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|