C21H35NO6 — CID 164592967
3-[2-[2-[6-[4-(1-aminoethyl)phenoxy]hexoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 164592967) has the molecular formula C21H35NO6 and a molecular weight of 397.51 g/mol. Its IUPAC name is 3-[2-[2-[6-[4-(1-aminoethyl)phenoxy]hexoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[6-[4-(1-aminoethyl)phenoxy]hexoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 164592967 |
| Molecular Formula | C21H35NO6 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 3-[2-[2-[6-[4-(1-aminoethyl)phenoxy]hexoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | CC(N)c1ccc(OCCCCCCOCCOCCOCCC(=O)O)cc1 |
| InChI | InChI=1S/C21H35NO6/c1-18(22)19-6-8-20(9-7-19)28-12-5-3-2-4-11-25-14-16-27-17-15-26-13-10-21(23)24/h6-9,18H,2-5,10-17,22H2,1H3,(H,23,24) |
| InChIKey | WPGFLGMFIJVYNY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|