C28H49NO6 — CID 167192994
tert-butyl 6-[2-[2-[6-[4-[(1R)-1-aminoethyl]phenoxy]hexoxy]ethoxy]ethoxy]hexanoate (PubChem CID 167192994) has the molecular formula C28H49NO6 and a molecular weight of 495.70 g/mol. Its IUPAC name is tert-butyl 6-[2-[2-[6-[4-[(1R)-1-aminoethyl]phenoxy]hexoxy]ethoxy]ethoxy]hexanoate.
| Compound Name | tert-butyl 6-[2-[2-[6-[4-[(1R)-1-aminoethyl]phenoxy]hexoxy]ethoxy]ethoxy]hexanoate |
|---|---|
| PubChem CID | 167192994 |
| Molecular Formula | C28H49NO6 |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 495.36 |
| IUPAC Name | tert-butyl 6-[2-[2-[6-[4-[(1R)-1-aminoethyl]phenoxy]hexoxy]ethoxy]ethoxy]hexanoate |
| SMILES | C[C@@H](N)c1ccc(OCCCCCCOCCOCCOCCCCCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C28H49NO6/c1-24(29)25-13-15-26(16-14-25)34-19-11-6-5-9-17-31-20-22-33-23-21-32-18-10-7-8-12-27(30)35-28(2,3)4/h13-16,24H,5-12,17-23,29H2,1-4H3/t24-/m1/s1 |
| InChIKey | OFAXNWDUYZKKCH-XMMPIXPASA-N |
| XLogP | 5.60 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|