C14H28O6 — CID 87242524
tert-butyl 6-[2-(2-hydroperoxyethoxy)ethoxy]hexanoate (PubChem CID 87242524) has the molecular formula C14H28O6 and a molecular weight of 292.37 g/mol. Its IUPAC name is tert-butyl 6-[2-(2-hydroperoxyethoxy)ethoxy]hexanoate.
| Compound Name | tert-butyl 6-[2-(2-hydroperoxyethoxy)ethoxy]hexanoate |
|---|---|
| PubChem CID | 87242524 |
| Molecular Formula | C14H28O6 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | tert-butyl 6-[2-(2-hydroperoxyethoxy)ethoxy]hexanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCOCCOCCOO |
| InChI | InChI=1S/C14H28O6/c1-14(2,3)20-13(15)7-5-4-6-8-17-9-10-18-11-12-19-16/h16H,4-12H2,1-3H3 |
| InChIKey | APJYXNTYYBKMMU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|