C13H25BrO3 — CID 165436316
tert-butyl 3-(6-bromohexoxy)propanoate (PubChem CID 165436316) has the molecular formula C13H25BrO3 and a molecular weight of 309.24 g/mol. Its IUPAC name is tert-butyl 3-(6-bromohexoxy)propanoate.
| Compound Name | tert-butyl 3-(6-bromohexoxy)propanoate |
|---|---|
| PubChem CID | 165436316 |
| Molecular Formula | C13H25BrO3 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | tert-butyl 3-(6-bromohexoxy)propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCCCCCBr |
| InChI | InChI=1S/C13H25BrO3/c1-13(2,3)17-12(15)8-11-16-10-7-5-4-6-9-14/h4-11H2,1-3H3 |
| InChIKey | DSMZSBTUDCWENF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|