C22H38N2O5 — CID 170003687
tert-butyl 2-[3-[5-[4-[(1S)-1-hydrazinylethyl]phenoxy]pentoxy]propoxy]acetate (PubChem CID 170003687) has the molecular formula C22H38N2O5 and a molecular weight of 410.56 g/mol. Its IUPAC name is tert-butyl 2-[3-[5-[4-[(1S)-1-hydrazinylethyl]phenoxy]pentoxy]propoxy]acetate.
| Compound Name | tert-butyl 2-[3-[5-[4-[(1S)-1-hydrazinylethyl]phenoxy]pentoxy]propoxy]acetate |
|---|---|
| PubChem CID | 170003687 |
| Molecular Formula | C22H38N2O5 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | tert-butyl 2-[3-[5-[4-[(1S)-1-hydrazinylethyl]phenoxy]pentoxy]propoxy]acetate |
| SMILES | C[C@H](NN)c1ccc(OCCCCCOCCCOCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H38N2O5/c1-18(24-23)19-9-11-20(12-10-19)28-16-7-5-6-13-26-14-8-15-27-17-21(25)29-22(2,3)4/h9-12,18,24H,5-8,13-17,23H2,1-4H3/t18-/m0/s1 |
| InChIKey | FLRPNGIOGLMYBC-SFHVURJKSA-N |
| XLogP | 3.53 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|