C21H28N2O4 — CID 167366130
tert-butyl 2-[4-[4-(5-amino-2-pyridinyl)phenoxy]butoxy]acetate (PubChem CID 167366130) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-(5-amino-2-pyridinyl)phenoxy]butoxy]acetate.
| Compound Name | tert-butyl 2-[4-[4-(5-amino-2-pyridinyl)phenoxy]butoxy]acetate |
|---|---|
| PubChem CID | 167366130 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | tert-butyl 2-[4-[4-(5-amino-2-pyridinyl)phenoxy]butoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCCCOc1ccc(-c2ccc(N)cn2)cc1 |
| InChI | InChI=1S/C21H28N2O4/c1-21(2,3)27-20(24)15-25-12-4-5-13-26-18-9-6-16(7-10-18)19-11-8-17(22)14-23-19/h6-11,14H,4-5,12-13,15,22H2,1-3H3 |
| InChIKey | ODOAVFXDABGGDB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|