C36H56N2O14 — CID 162116260
tert-butyl 2-[2-[2-[2-(4-aminophenoxy)ethoxy]ethoxy]ethoxy]acetate;tert-butyl 2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetate (PubChem CID 162116260) has the molecular formula C36H56N2O14 and a molecular weight of 740.84 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-(4-aminophenoxy)ethoxy]ethoxy]ethoxy]acetate;tert-butyl 2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[2-(4-aminophenoxy)ethoxy]ethoxy]ethoxy]acetate;tert-butyl 2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 162116260 |
| Molecular Formula | C36H56N2O14 |
| Molecular Weight | 740.84 g/mol |
| Exact Mass | 740.37 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-(4-aminophenoxy)ethoxy]ethoxy]ethoxy]acetate;tert-butyl 2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOc1ccc(N)cc1.CC(C)(C)OC(=O)COCCOCCOCCOc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H27NO8.C18H29NO6/c1-18(2,3)27-17(20)14-25-11-10-23-8-9-24-12-13-26-16-6-4-15(5-7-16)19(21)22;1-18(2,3)25-17(20)14-23-11-10-21-8-9-22-12-13-24-16-6-4-15(19)5-7-16/h4-7H,8-14H2,1-3H3;4-7H,8-14,19H2,1-3H3 |
| InChIKey | ZGUNAJYFPVZRTA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.84 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|