C36H52F4N2O14 — CID 162135765
tert-butyl 2-[2-[2-[2-(4-amino-2,6-difluorophenoxy)ethoxy]ethoxy]ethoxy]acetate;tert-butyl 2-[2-[2-[2-(2,6-difluoro-4-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetate (PubChem CID 162135765) has the molecular formula C36H52F4N2O14 and a molecular weight of 812.80 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-(4-amino-2,6-difluorophenoxy)ethoxy]ethoxy]ethoxy]acetate;tert-butyl 2-[2-[2-[2-(2,6-difluoro-4-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[2-(4-amino-2,6-difluorophenoxy)ethoxy]ethoxy]ethoxy]acetate;tert-butyl 2-[2-[2-[2-(2,6-difluoro-4-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 162135765 |
| Molecular Formula | C36H52F4N2O14 |
| Molecular Weight | 812.80 g/mol |
| Exact Mass | 812.34 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-(4-amino-2,6-difluorophenoxy)ethoxy]ethoxy]ethoxy]acetate;tert-butyl 2-[2-[2-[2-(2,6-difluoro-4-nitrophenoxy)ethoxy]ethoxy]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOc1c(F)cc(N)cc1F.CC(C)(C)OC(=O)COCCOCCOCCOc1c(F)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C18H25F2NO8.C18H27F2NO6/c1-18(2,3)29-16(22)12-27-7-6-25-4-5-26-8-9-28-17-14(19)10-13(21(23)24)11-15(17)20;1-18(2,3)27-16(22)12-25-7-6-23-4-5-24-8-9-26-17-14(19)10-13(21)11-15(17)20/h10-11H,4-9,12H2,1-3H3;10-11H,4-9,12,21H2,1-3H3 |
| InChIKey | ZJGKPWINTRZFCD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.80 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|