C18H29NO4 — CID 126671533
1-[3-[3-[4-[(1R)-1-(methylamino)ethyl]phenoxy]propoxy]propoxy]propan-2-one (PubChem CID 126671533) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is 1-[3-[3-[4-[(1R)-1-(methylamino)ethyl]phenoxy]propoxy]propoxy]propan-2-one.
| Compound Name | 1-[3-[3-[4-[(1R)-1-(methylamino)ethyl]phenoxy]propoxy]propoxy]propan-2-one |
|---|---|
| PubChem CID | 126671533 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 1-[3-[3-[4-[(1R)-1-(methylamino)ethyl]phenoxy]propoxy]propoxy]propan-2-one |
| SMILES | CN[C@H](C)c1ccc(OCCCOCCCOCC(C)=O)cc1 |
| InChI | InChI=1S/C18H29NO4/c1-15(20)14-22-12-4-10-21-11-5-13-23-18-8-6-17(7-9-18)16(2)19-3/h6-9,16,19H,4-5,10-14H2,1-3H3/t16-/m1/s1 |
| InChIKey | LFHSWMDRLUGOAM-MRXNPFEDSA-N |
| XLogP | 2.75 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|