C20H33NO5 — CID 135216960
3-methyl-1-[2-[2-[4-[4-(methylamino)phenoxy]butoxy]ethoxy]ethoxy]butan-2-one (PubChem CID 135216960) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is 3-methyl-1-[2-[2-[4-[4-(methylamino)phenoxy]butoxy]ethoxy]ethoxy]butan-2-one.
| Compound Name | 3-methyl-1-[2-[2-[4-[4-(methylamino)phenoxy]butoxy]ethoxy]ethoxy]butan-2-one |
|---|---|
| PubChem CID | 135216960 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 3-methyl-1-[2-[2-[4-[4-(methylamino)phenoxy]butoxy]ethoxy]ethoxy]butan-2-one |
| SMILES | CNc1ccc(OCCCCOCCOCCOCC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C20H33NO5/c1-17(2)20(22)16-25-15-14-24-13-12-23-10-4-5-11-26-19-8-6-18(21-3)7-9-19/h6-9,17,21H,4-5,10-16H2,1-3H3 |
| InChIKey | KYVKNVUDFXQHCD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|