C19H27F3O3 — CID 167366044
3-methyl-1-[4-[4-propan-2-yl-3-(trifluoromethyl)phenoxy]butoxy]butan-2-one (PubChem CID 167366044) has the molecular formula C19H27F3O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is 3-methyl-1-[4-[4-propan-2-yl-3-(trifluoromethyl)phenoxy]butoxy]butan-2-one.
| Compound Name | 3-methyl-1-[4-[4-propan-2-yl-3-(trifluoromethyl)phenoxy]butoxy]butan-2-one |
|---|---|
| PubChem CID | 167366044 |
| Molecular Formula | C19H27F3O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 3-methyl-1-[4-[4-propan-2-yl-3-(trifluoromethyl)phenoxy]butoxy]butan-2-one |
| SMILES | CC(C)C(=O)COCCCCOc1ccc(C(C)C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H27F3O3/c1-13(2)16-8-7-15(11-17(16)19(20,21)22)25-10-6-5-9-24-12-18(23)14(3)4/h7-8,11,13-14H,5-6,9-10,12H2,1-4H3 |
| InChIKey | XOUSBRBENITWHL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|