C21H35NO4 — CID 146520253
4-methyl-1-[3-[3-[4-(propan-2-ylamino)phenoxy]propoxy]propoxy]pentan-2-one (PubChem CID 146520253) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is 4-methyl-1-[3-[3-[4-(propan-2-ylamino)phenoxy]propoxy]propoxy]pentan-2-one.
| Compound Name | 4-methyl-1-[3-[3-[4-(propan-2-ylamino)phenoxy]propoxy]propoxy]pentan-2-one |
|---|---|
| PubChem CID | 146520253 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 4-methyl-1-[3-[3-[4-(propan-2-ylamino)phenoxy]propoxy]propoxy]pentan-2-one |
| SMILES | CC(C)CC(=O)COCCCOCCCOc1ccc(NC(C)C)cc1 |
| InChI | InChI=1S/C21H35NO4/c1-17(2)15-20(23)16-25-13-5-11-24-12-6-14-26-21-9-7-19(8-10-21)22-18(3)4/h7-10,17-18,22H,5-6,11-16H2,1-4H3 |
| InChIKey | AOWUHJXWBHZEJA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|