C18H33NO5 — CID 142365442
ethane;1-[2-[2-[2-[4-(methylamino)phenoxy]ethoxy]ethoxy]ethoxy]propan-2-one;molecular hydrogen (PubChem CID 142365442) has the molecular formula C18H33NO5 and a molecular weight of 343.46 g/mol. Its IUPAC name is ethane;1-[2-[2-[2-[4-(methylamino)phenoxy]ethoxy]ethoxy]ethoxy]propan-2-one;molecular hydrogen.
| Compound Name | ethane;1-[2-[2-[2-[4-(methylamino)phenoxy]ethoxy]ethoxy]ethoxy]propan-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 142365442 |
| Molecular Formula | C18H33NO5 |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | ethane;1-[2-[2-[2-[4-(methylamino)phenoxy]ethoxy]ethoxy]ethoxy]propan-2-one;molecular hydrogen |
| SMILES | CC.CNc1ccc(OCCOCCOCCOCC(C)=O)cc1.[H][H] |
| InChI | InChI=1S/C16H25NO5.C2H6.H2/c1-14(18)13-21-10-9-19-7-8-20-11-12-22-16-5-3-15(17-2)4-6-16;1-2;/h3-6,17H,7-13H2,1-2H3;1-2H3;1H |
| InChIKey | QRUFAWGWAKAASY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|