C17H27NO7 — CID 58687735
2-[2-[2-[4-[2-[2-(methylamino)ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]acetic acid (PubChem CID 58687735) has the molecular formula C17H27NO7 and a molecular weight of 357.40 g/mol. Its IUPAC name is 2-[2-[2-[4-[2-[2-(methylamino)ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[4-[2-[2-(methylamino)ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 58687735 |
| Molecular Formula | C17H27NO7 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 2-[2-[2-[4-[2-[2-(methylamino)ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]acetic acid |
| SMILES | CNCCOCCOc1ccc(OCCOCCOCC(=O)O)cc1 |
| InChI | InChI=1S/C17H27NO7/c1-18-6-7-21-10-12-24-15-2-4-16(5-3-15)25-13-11-22-8-9-23-14-17(19)20/h2-5,18H,6-14H2,1H3,(H,19,20) |
| InChIKey | AHSDBPRZFPNNLL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|