C14H18O6 — CID 59205630
2-[2-[4-(3-oxobutan-2-yloxy)phenoxy]ethoxy]acetic acid (PubChem CID 59205630) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 2-[2-[4-(3-oxobutan-2-yloxy)phenoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-(3-oxobutan-2-yloxy)phenoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 59205630 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-[2-[4-(3-oxobutan-2-yloxy)phenoxy]ethoxy]acetic acid |
| SMILES | CC(=O)C(C)Oc1ccc(OCCOCC(=O)O)cc1 |
| InChI | InChI=1S/C14H18O6/c1-10(15)11(2)20-13-5-3-12(4-6-13)19-8-7-18-9-14(16)17/h3-6,11H,7-9H2,1-2H3,(H,16,17) |
| InChIKey | QTKDIERLHXXDMM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|