C22H21O9+ — CID 147068976
2-[4-[7-[2-(carboxymethoxy)ethoxy]-4-oxochromen-3-yl]phenoxy]propanoyloxidanium (PubChem CID 147068976) has the molecular formula C22H21O9+ and a molecular weight of 429.40 g/mol. Its IUPAC name is 2-[4-[7-[2-(carboxymethoxy)ethoxy]-4-oxochromen-3-yl]phenoxy]propanoyloxidanium.
| Compound Name | 2-[4-[7-[2-(carboxymethoxy)ethoxy]-4-oxochromen-3-yl]phenoxy]propanoyloxidanium |
|---|---|
| PubChem CID | 147068976 |
| Molecular Formula | C22H21O9+ |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 2-[4-[7-[2-(carboxymethoxy)ethoxy]-4-oxochromen-3-yl]phenoxy]propanoyloxidanium |
| SMILES | CC(Oc1ccc(-c2coc3cc(OCCOCC(=O)O)ccc3c2=O)cc1)C(=O)[OH2+] |
| InChI | InChI=1S/C22H20O9/c1-13(22(26)27)31-15-4-2-14(3-5-15)18-11-30-19-10-16(6-7-17(19)21(18)25)29-9-8-28-12-20(23)24/h2-7,10-11,13H,8-9,12H2,1H3,(H,23,24)(H,26,27)/p+1 |
| InChIKey | BERCLWHQYBPGIB-UHFFFAOYSA-O |
| XLogP | 1.96 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|