C18H13ClO5 — CID 693182
(2R)-2-[3-(4-chlorophenyl)-4-oxochromen-7-yl]oxypropanoic acid (PubChem CID 693182) has the molecular formula C18H13ClO5 and a molecular weight of 344.75 g/mol. Its IUPAC name is (2R)-2-[3-(4-chlorophenyl)-4-oxochromen-7-yl]oxypropanoic acid.
| Compound Name | (2R)-2-[3-(4-chlorophenyl)-4-oxochromen-7-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 693182 |
| Molecular Formula | C18H13ClO5 |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | (2R)-2-[3-(4-chlorophenyl)-4-oxochromen-7-yl]oxypropanoic acid |
| SMILES | C[C@@H](Oc1ccc2c(=O)c(-c3ccc(Cl)cc3)coc2c1)C(=O)O |
| InChI | InChI=1S/C18H13ClO5/c1-10(18(21)22)24-13-6-7-14-16(8-13)23-9-15(17(14)20)11-2-4-12(19)5-3-11/h2-10H,1H3,(H,21,22)/t10-/m1/s1 |
| InChIKey | CTMABIYOLDOKQE-SNVBAGLBSA-N |
| XLogP | 3.97 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |