C22H20O9 — CID 147068977
2-[4-[7-[2-(carboxymethoxy)ethoxy]-4-oxochromen-3-yl]phenoxy]propanoic acid (PubChem CID 147068977) has the molecular formula C22H20O9 and a molecular weight of 428.39 g/mol. Its IUPAC name is 2-[4-[7-[2-(carboxymethoxy)ethoxy]-4-oxochromen-3-yl]phenoxy]propanoic acid.
| Compound Name | 2-[4-[7-[2-(carboxymethoxy)ethoxy]-4-oxochromen-3-yl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 147068977 |
| Molecular Formula | C22H20O9 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2-[4-[7-[2-(carboxymethoxy)ethoxy]-4-oxochromen-3-yl]phenoxy]propanoic acid |
| SMILES | CC(Oc1ccc(-c2coc3cc(OCCOCC(=O)O)ccc3c2=O)cc1)C(=O)O |
| InChI | InChI=1S/C22H20O9/c1-13(22(26)27)31-15-4-2-14(3-5-15)18-11-30-19-10-16(6-7-17(19)21(18)25)29-9-8-28-12-20(23)24/h2-7,10-11,13H,8-9,12H2,1H3,(H,23,24)(H,26,27) |
| InChIKey | BERCLWHQYBPGIB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|