C12H27NO4 — CID 155740359
ethane;1-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propan-2-one (PubChem CID 155740359) has the molecular formula C12H27NO4 and a molecular weight of 249.35 g/mol. Its IUPAC name is ethane;1-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propan-2-one.
| Compound Name | ethane;1-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propan-2-one |
|---|---|
| PubChem CID | 155740359 |
| Molecular Formula | C12H27NO4 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | ethane;1-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propan-2-one |
| SMILES | CC.CNCCOCCOCCOCC(C)=O |
| InChI | InChI=1S/C10H21NO4.C2H6/c1-10(12)9-15-8-7-14-6-5-13-4-3-11-2;1-2/h11H,3-9H2,1-2H3;1-2H3 |
| InChIKey | VABJPBSLQYRMOC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|