C9H19NO3 — CID 59450621
4-[2-[2-(methylamino)ethoxy]ethoxy]butan-2-one (PubChem CID 59450621) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is 4-[2-[2-(methylamino)ethoxy]ethoxy]butan-2-one.
| Compound Name | 4-[2-[2-(methylamino)ethoxy]ethoxy]butan-2-one |
|---|---|
| PubChem CID | 59450621 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | 4-[2-[2-(methylamino)ethoxy]ethoxy]butan-2-one |
| SMILES | CNCCOCCOCCC(C)=O |
| InChI | InChI=1S/C9H19NO3/c1-9(11)3-5-12-7-8-13-6-4-10-2/h10H,3-8H2,1-2H3 |
| InChIKey | DIJYSEGAZPEJSW-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|