C16H33NO5 — CID 177194352
4-[2-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]ethoxy]butan-2-one (PubChem CID 177194352) has the molecular formula C16H33NO5 and a molecular weight of 319.44 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]ethoxy]butan-2-one.
| Compound Name | 4-[2-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]ethoxy]butan-2-one |
|---|---|
| PubChem CID | 177194352 |
| Molecular Formula | C16H33NO5 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | 4-[2-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]ethoxy]butan-2-one |
| SMILES | CC(=O)CCOCCOCCOCCOCCNC(C)(C)C |
| InChI | InChI=1S/C16H33NO5/c1-15(18)5-7-19-9-11-21-13-14-22-12-10-20-8-6-17-16(2,3)4/h17H,5-14H2,1-4H3 |
| InChIKey | WGTSQBIAPIXGAU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|