C7H14N2O3 — CID 176664573
2-(3-oxobutoxy)ethylurea (PubChem CID 176664573) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-(3-oxobutoxy)ethylurea.
| Compound Name | 2-(3-oxobutoxy)ethylurea |
|---|---|
| PubChem CID | 176664573 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2-(3-oxobutoxy)ethylurea |
| SMILES | CC(=O)CCOCCNC(N)=O |
| InChI | InChI=1S/C7H14N2O3/c1-6(10)2-4-12-5-3-9-7(8)11/h2-5H2,1H3,(H3,8,9,11) |
| InChIKey | WCNVSRDZQVRDCY-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|