C26H33NO3 — CID 58757918
N-methyl-4-[(1E,3E,5E)-6-[4-[2-(2-propoxyethoxy)ethoxy]phenyl]hexa-1,3,5-trienyl]aniline (PubChem CID 58757918) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is N-methyl-4-[(1E,3E,5E)-6-[4-[2-(2-propoxyethoxy)ethoxy]phenyl]hexa-1,3,5-trienyl]aniline.
| Compound Name | N-methyl-4-[(1E,3E,5E)-6-[4-[2-(2-propoxyethoxy)ethoxy]phenyl]hexa-1,3,5-trienyl]aniline |
|---|---|
| PubChem CID | 58757918 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | N-methyl-4-[(1E,3E,5E)-6-[4-[2-(2-propoxyethoxy)ethoxy]phenyl]hexa-1,3,5-trienyl]aniline |
| SMILES | CCCOCCOCCOc1ccc(/C=C/C=C/C=C/c2ccc(NC)cc2)cc1 |
| InChI | InChI=1S/C26H33NO3/c1-3-18-28-19-20-29-21-22-30-26-16-12-24(13-17-26)9-7-5-4-6-8-23-10-14-25(27-2)15-11-23/h4-17,27H,3,18-22H2,1-2H3/b5-4+,8-6+,9-7+ |
| InChIKey | MIDBDPAXQWOTJU-WUJFNTSISA-N |
| XLogP | 5.83 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|