C21H28N2O4 — CID 89181117
4-[(E)-2-[6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]ethenyl]-N-methylaniline (PubChem CID 89181117) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-[(E)-2-[6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]ethenyl]-N-methylaniline.
| Compound Name | 4-[(E)-2-[6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]ethenyl]-N-methylaniline |
|---|---|
| PubChem CID | 89181117 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 4-[(E)-2-[6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]ethenyl]-N-methylaniline |
| SMILES | CNc1ccc(/C=C/c2ccc(OCCOCCOCCOC)nc2)cc1 |
| InChI | InChI=1S/C21H28N2O4/c1-22-20-8-5-18(6-9-20)3-4-19-7-10-21(23-17-19)27-16-15-26-14-13-25-12-11-24-2/h3-10,17,22H,11-16H2,1-2H3/b4-3+ |
| InChIKey | WGBIVAKDQVHCHV-ONEGZZNKSA-N |
| XLogP | 3.35 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|