C23H29BrN4O5 — CID 172537257
2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-5-[(E)-2-(4-bromophenyl)ethenyl]pyridine (PubChem CID 172537257) has the molecular formula C23H29BrN4O5 and a molecular weight of 521.41 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-5-[(E)-2-(4-bromophenyl)ethenyl]pyridine.
| Compound Name | 2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-5-[(E)-2-(4-bromophenyl)ethenyl]pyridine |
|---|---|
| PubChem CID | 172537257 |
| Molecular Formula | C23H29BrN4O5 |
| Molecular Weight | 521.41 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-5-[(E)-2-(4-bromophenyl)ethenyl]pyridine |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOc1ccc(/C=C/c2ccc(Br)cc2)cn1 |
| InChI | InChI=1S/C23H29BrN4O5/c24-22-6-3-20(4-7-22)1-2-21-5-8-23(26-19-21)33-18-17-32-16-15-31-14-13-30-12-11-29-10-9-27-28-25/h1-8,19H,9-18H2/b2-1+ |
| InChIKey | KDXDNBXKINZVKL-OWOJBTEDSA-N |
| XLogP | 4.77 |
| TPSA | 107.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|