C20H29N3O8 — CID 122546581
2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]terephthalaldehyde (PubChem CID 122546581) has the molecular formula C20H29N3O8 and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]terephthalaldehyde.
| Compound Name | 2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]terephthalaldehyde |
|---|---|
| PubChem CID | 122546581 |
| Molecular Formula | C20H29N3O8 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]terephthalaldehyde |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCOc1cc(C=O)ccc1C=O |
| InChI | InChI=1S/C20H29N3O8/c21-23-22-3-4-26-5-6-27-7-8-28-9-10-29-11-12-30-13-14-31-20-15-18(16-24)1-2-19(20)17-25/h1-2,15-17H,3-14H2 |
| InChIKey | OJMPFFZNESQDCL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 138.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|