C20H24BrFN2O3 — CID 91048351
4-[2-[5-bromo-6-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-3-pyridinyl]ethenyl]-N-methylaniline (PubChem CID 91048351) has the molecular formula C20H24BrFN2O3 and a molecular weight of 439.33 g/mol. Its IUPAC name is 4-[2-[5-bromo-6-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-3-pyridinyl]ethenyl]-N-methylaniline.
| Compound Name | 4-[2-[5-bromo-6-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-3-pyridinyl]ethenyl]-N-methylaniline |
|---|---|
| PubChem CID | 91048351 |
| Molecular Formula | C20H24BrFN2O3 |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 4-[2-[5-bromo-6-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-3-pyridinyl]ethenyl]-N-methylaniline |
| SMILES | CNc1ccc(C=Cc2cnc(OCCOCCOCCF)c(Br)c2)cc1 |
| InChI | InChI=1S/C20H24BrFN2O3/c1-23-18-6-4-16(5-7-18)2-3-17-14-19(21)20(24-15-17)27-13-12-26-11-10-25-9-8-22/h2-7,14-15,23H,8-13H2,1H3 |
| InChIKey | BVYDHFIWSSIQNH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|