C28H44N2O2Sn — CID 67384659
2-[[5-[2-[4-(methylamino)phenyl]ethenyl]-3-tributylstannyl-2-pyridinyl]oxy]ethanol (PubChem CID 67384659) has the molecular formula C28H44N2O2Sn and a molecular weight of 559.38 g/mol. Its IUPAC name is 2-[[5-[2-[4-(methylamino)phenyl]ethenyl]-3-tributylstannyl-2-pyridinyl]oxy]ethanol.
| Compound Name | 2-[[5-[2-[4-(methylamino)phenyl]ethenyl]-3-tributylstannyl-2-pyridinyl]oxy]ethanol |
|---|---|
| PubChem CID | 67384659 |
| Molecular Formula | C28H44N2O2Sn |
| Molecular Weight | 559.38 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 2-[[5-[2-[4-(methylamino)phenyl]ethenyl]-3-tributylstannyl-2-pyridinyl]oxy]ethanol |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(C=Cc2ccc(NC)cc2)cnc1OCCO |
| InChI | InChI=1S/C16H17N2O2.3C4H9.Sn/c1-17-15-7-4-13(5-8-15)2-3-14-6-9-16(18-12-14)20-11-10-19;3*1-3-4-2;/h2-8,12,17,19H,10-11H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | SHQLSTVJDOCJKB-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.38 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |