C19H22FNO — CID 45485172
4-[(E)-2-[4-(4-fluorobutoxy)phenyl]ethenyl]-N-methylaniline (PubChem CID 45485172) has the molecular formula C19H22FNO and a molecular weight of 299.39 g/mol. Its IUPAC name is 4-[(E)-2-[4-(4-fluorobutoxy)phenyl]ethenyl]-N-methylaniline.
| Compound Name | 4-[(E)-2-[4-(4-fluorobutoxy)phenyl]ethenyl]-N-methylaniline |
|---|---|
| PubChem CID | 45485172 |
| Molecular Formula | C19H22FNO |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 4-[(E)-2-[4-(4-fluorobutoxy)phenyl]ethenyl]-N-methylaniline |
| SMILES | CNc1ccc(/C=C/c2ccc(OCCCCF)cc2)cc1 |
| InChI | InChI=1S/C19H22FNO/c1-21-18-10-6-16(7-11-18)4-5-17-8-12-19(13-9-17)22-15-3-2-14-20/h4-13,21H,2-3,14-15H2,1H3/b5-4+ |
| InChIKey | JOBDZRATDLECSG-SNAWJCMRSA-N |
| XLogP | 5.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|