C17H18INO2 — CID 91579470
2-[3-(123I)iodo-5-[2-[4-(methylamino)phenyl]ethenyl]phenoxy]ethanol (PubChem CID 91579470) has the molecular formula C17H18INO2 and a molecular weight of 391.24 g/mol. Its IUPAC name is 2-[3-(123I)iodo-5-[2-[4-(methylamino)phenyl]ethenyl]phenoxy]ethanol.
| Compound Name | 2-[3-(123I)iodo-5-[2-[4-(methylamino)phenyl]ethenyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 91579470 |
| Molecular Formula | C17H18INO2 |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 2-[3-(123I)iodo-5-[2-[4-(methylamino)phenyl]ethenyl]phenoxy]ethanol |
| SMILES | CNc1ccc(C=Cc2cc([123I])cc(OCCO)c2)cc1 |
| InChI | InChI=1S/C17H18INO2/c1-19-16-6-4-13(5-7-16)2-3-14-10-15(18)12-17(11-14)21-9-8-20/h2-7,10-12,19-20H,8-9H2,1H3/i18-4 |
| InChIKey | IOHQASJVRDTZLL-GSLGWBAQSA-N |
| XLogP | 3.87 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|