C20H21FN2O2 — CID 142842122
4-[(E)-2-[6-(4-fluorobutoxy)-1,3-benzoxazol-2-yl]ethenyl]-N-methylaniline (PubChem CID 142842122) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is 4-[(E)-2-[6-(4-fluorobutoxy)-1,3-benzoxazol-2-yl]ethenyl]-N-methylaniline.
| Compound Name | 4-[(E)-2-[6-(4-fluorobutoxy)-1,3-benzoxazol-2-yl]ethenyl]-N-methylaniline |
|---|---|
| PubChem CID | 142842122 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-[(E)-2-[6-(4-fluorobutoxy)-1,3-benzoxazol-2-yl]ethenyl]-N-methylaniline |
| SMILES | CNc1ccc(/C=C/c2nc3ccc(OCCCCF)cc3o2)cc1 |
| InChI | InChI=1S/C20H21FN2O2/c1-22-16-7-4-15(5-8-16)6-11-20-23-18-10-9-17(14-19(18)25-20)24-13-3-2-12-21/h4-11,14,22H,2-3,12-13H2,1H3/b11-6+ |
| InChIKey | MXICIWGSNWNDCC-IZZDOVSWSA-N |
| XLogP | 5.17 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|