C28H31N3O3 — CID 24816014
4-[(E)-2-[6-[2-[2-(benzylamino)ethoxy]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 24816014) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is 4-[(E)-2-[6-[2-[2-(benzylamino)ethoxy]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[6-[2-[2-(benzylamino)ethoxy]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 24816014 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 4-[(E)-2-[6-[2-[2-(benzylamino)ethoxy]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2nc3ccc(OCCOCCNCc4ccccc4)cc3o2)cc1 |
| InChI | InChI=1S/C28H31N3O3/c1-31(2)24-11-8-22(9-12-24)10-15-28-30-26-14-13-25(20-27(26)34-28)33-19-18-32-17-16-29-21-23-6-4-3-5-7-23/h3-15,20,29H,16-19,21H2,1-2H3/b15-10+ |
| InChIKey | JSDLXSQMZHBZLH-XNTDXEJSSA-N |
| XLogP | 5.25 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|