C28H30N2O5 — CID 1497034
3,4,5-triethoxy-N-[2-(4-ethylphenyl)-1,3-benzoxazol-5-yl]benzamide (PubChem CID 1497034) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[2-(4-ethylphenyl)-1,3-benzoxazol-5-yl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[2-(4-ethylphenyl)-1,3-benzoxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 1497034 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 3,4,5-triethoxy-N-[2-(4-ethylphenyl)-1,3-benzoxazol-5-yl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc3oc(-c4ccc(CC)cc4)nc3c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C28H30N2O5/c1-5-18-9-11-19(12-10-18)28-30-22-17-21(13-14-23(22)35-28)29-27(31)20-15-24(32-6-2)26(34-8-4)25(16-20)33-7-3/h9-17H,5-8H2,1-4H3,(H,29,31) |
| InChIKey | RVGJELVAOBBOLW-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |