C24H21BrN2O3 — CID 73254674
3-bromo-4-ethoxy-N-[2-(4-ethylphenyl)-1,3-benzoxazol-6-yl]benzamide (PubChem CID 73254674) has the molecular formula C24H21BrN2O3 and a molecular weight of 465.35 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-N-[2-(4-ethylphenyl)-1,3-benzoxazol-6-yl]benzamide.
| Compound Name | 3-bromo-4-ethoxy-N-[2-(4-ethylphenyl)-1,3-benzoxazol-6-yl]benzamide |
|---|---|
| PubChem CID | 73254674 |
| Molecular Formula | C24H21BrN2O3 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 3-bromo-4-ethoxy-N-[2-(4-ethylphenyl)-1,3-benzoxazol-6-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc3nc(-c4ccc(CC)cc4)oc3c2)cc1Br |
| InChI | InChI=1S/C24H21BrN2O3/c1-3-15-5-7-16(8-6-15)24-27-20-11-10-18(14-22(20)30-24)26-23(28)17-9-12-21(29-4-2)19(25)13-17/h5-14H,3-4H2,1-2H3,(H,26,28) |
| InChIKey | CXGFMVZERPXABF-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |