C20H16N2O2S — CID 3013323
N-[2-(4-ethylphenyl)-1,3-benzoxazol-5-yl]thiophene-2-carboxamide (PubChem CID 3013323) has the molecular formula C20H16N2O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is N-[2-(4-ethylphenyl)-1,3-benzoxazol-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[2-(4-ethylphenyl)-1,3-benzoxazol-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3013323 |
| Molecular Formula | C20H16N2O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-[2-(4-ethylphenyl)-1,3-benzoxazol-5-yl]thiophene-2-carboxamide |
| SMILES | CCc1ccc(-c2nc3cc(NC(=O)c4cccs4)ccc3o2)cc1 |
| InChI | InChI=1S/C20H16N2O2S/c1-2-13-5-7-14(8-6-13)20-22-16-12-15(9-10-17(16)24-20)21-19(23)18-4-3-11-25-18/h3-12H,2H2,1H3,(H,21,23) |
| InChIKey | BHXXFHHQTDBSHS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |