C26H25ClF3N3O3 — CID 25255354
N,N-dimethyl-4-[(E)-2-[6-[2-[4-(trifluoromethoxy)anilino]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]aniline;hydrochloride (PubChem CID 25255354) has the molecular formula C26H25ClF3N3O3 and a molecular weight of 519.95 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[6-[2-[4-(trifluoromethoxy)anilino]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]aniline;hydrochloride.
| Compound Name | N,N-dimethyl-4-[(E)-2-[6-[2-[4-(trifluoromethoxy)anilino]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]aniline;hydrochloride |
|---|---|
| PubChem CID | 25255354 |
| Molecular Formula | C26H25ClF3N3O3 |
| Molecular Weight | 519.95 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[6-[2-[4-(trifluoromethoxy)anilino]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]aniline;hydrochloride |
| SMILES | CN(C)c1ccc(/C=C/c2nc3ccc(OCCNc4ccc(OC(F)(F)F)cc4)cc3o2)cc1.Cl |
| InChI | InChI=1S/C26H24F3N3O3.ClH/c1-32(2)20-8-3-18(4-9-20)5-14-25-31-23-13-12-22(17-24(23)34-25)33-16-15-30-19-6-10-21(11-7-19)35-26(27,28)29;/h3-14,17,30H,15-16H2,1-2H3;1H/b14-5+; |
| InChIKey | RFNISCIQCHKZAT-OCSIRBNJSA-N |
| XLogP | 6.88 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.95 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|