C25H21F3N2O3 — CID 74324398
N,N-dimethyl-4-[2-[6-[[4-(trifluoromethoxy)phenyl]methoxy]-1,3-benzoxazol-2-yl]ethenyl]aniline (PubChem CID 74324398) has the molecular formula C25H21F3N2O3 and a molecular weight of 454.45 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-[6-[[4-(trifluoromethoxy)phenyl]methoxy]-1,3-benzoxazol-2-yl]ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-[6-[[4-(trifluoromethoxy)phenyl]methoxy]-1,3-benzoxazol-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 74324398 |
| Molecular Formula | C25H21F3N2O3 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N,N-dimethyl-4-[2-[6-[[4-(trifluoromethoxy)phenyl]methoxy]-1,3-benzoxazol-2-yl]ethenyl]aniline |
| SMILES | CN(C)c1ccc(C=Cc2nc3ccc(OCc4ccc(OC(F)(F)F)cc4)cc3o2)cc1 |
| InChI | InChI=1S/C25H21F3N2O3/c1-30(2)19-8-3-17(4-9-19)7-14-24-29-22-13-12-21(15-23(22)32-24)31-16-18-5-10-20(11-6-18)33-25(26,27)28/h3-15H,16H2,1-2H3 |
| InChIKey | RPDQFGBVYKHDEI-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|