C30H30ClF6N3O3 — CID 24815823
4-[(E)-2-[6-[2-[2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]ethoxy]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]-N,N-dimethylaniline;hydrochloride (PubChem CID 24815823) has the molecular formula C30H30ClF6N3O3 and a molecular weight of 630.03 g/mol. Its IUPAC name is 4-[(E)-2-[6-[2-[2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]ethoxy]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]-N,N-dimethylaniline;hydrochloride.
| Compound Name | 4-[(E)-2-[6-[2-[2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]ethoxy]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]-N,N-dimethylaniline;hydrochloride |
|---|---|
| PubChem CID | 24815823 |
| Molecular Formula | C30H30ClF6N3O3 |
| Molecular Weight | 630.03 g/mol |
| Exact Mass | 629.19 |
| IUPAC Name | 4-[(E)-2-[6-[2-[2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]ethoxy]ethoxy]-1,3-benzoxazol-2-yl]ethenyl]-N,N-dimethylaniline;hydrochloride |
| SMILES | CN(C)c1ccc(/C=C/c2nc3ccc(OCCOCCNCc4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc3o2)cc1.Cl |
| InChI | InChI=1S/C30H29F6N3O3.ClH/c1-39(2)24-6-3-20(4-7-24)5-10-28-38-26-9-8-25(18-27(26)42-28)41-14-13-40-12-11-37-19-21-15-22(29(31,32)33)17-23(16-21)30(34,35)36;/h3-10,15-18,37H,11-14,19H2,1-2H3;1H/b10-5+; |
| InChIKey | GRYIOBAXHLIHJK-OAZHBLANSA-N |
| XLogP | 7.71 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.03 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|