C17H17FN2O2 — CID 144970941
4-[6-(3-fluoropropoxy)-1,3-benzoxazol-2-yl]-N-methylaniline (PubChem CID 144970941) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is 4-[6-(3-fluoropropoxy)-1,3-benzoxazol-2-yl]-N-methylaniline.
| Compound Name | 4-[6-(3-fluoropropoxy)-1,3-benzoxazol-2-yl]-N-methylaniline |
|---|---|
| PubChem CID | 144970941 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-[6-(3-fluoropropoxy)-1,3-benzoxazol-2-yl]-N-methylaniline |
| SMILES | CNc1ccc(-c2nc3ccc(OCCCF)cc3o2)cc1 |
| InChI | InChI=1S/C17H17FN2O2/c1-19-13-5-3-12(4-6-13)17-20-15-8-7-14(11-16(15)22-17)21-10-2-9-18/h3-8,11,19H,2,9-10H2,1H3 |
| InChIKey | JMKYXWGDBCTJML-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|