C9H7ClFNO2 — CID 170558440
2-chloro-6-(2-fluoroethoxy)-1,3-benzoxazole (PubChem CID 170558440) has the molecular formula C9H7ClFNO2 and a molecular weight of 215.61 g/mol. Its IUPAC name is 2-chloro-6-(2-fluoroethoxy)-1,3-benzoxazole.
| Compound Name | 2-chloro-6-(2-fluoroethoxy)-1,3-benzoxazole |
|---|---|
| PubChem CID | 170558440 |
| Molecular Formula | C9H7ClFNO2 |
| Molecular Weight | 215.61 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | 2-chloro-6-(2-fluoroethoxy)-1,3-benzoxazole |
| SMILES | FCCOc1ccc2nc(Cl)oc2c1 |
| InChI | InChI=1S/C9H7ClFNO2/c10-9-12-7-2-1-6(13-4-3-11)5-8(7)14-9/h1-2,5H,3-4H2 |
| InChIKey | YBNADJDQDDVTDZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.61 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |