C9H5ClF3NO2 — CID 155083784
2-chloro-6-(2,2,2-trifluoroethoxy)-1,3-benzoxazole (PubChem CID 155083784) has the molecular formula C9H5ClF3NO2 and a molecular weight of 251.59 g/mol. Its IUPAC name is 2-chloro-6-(2,2,2-trifluoroethoxy)-1,3-benzoxazole.
| Compound Name | 2-chloro-6-(2,2,2-trifluoroethoxy)-1,3-benzoxazole |
|---|---|
| PubChem CID | 155083784 |
| Molecular Formula | C9H5ClF3NO2 |
| Molecular Weight | 251.59 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 2-chloro-6-(2,2,2-trifluoroethoxy)-1,3-benzoxazole |
| SMILES | FC(F)(F)COc1ccc2nc(Cl)oc2c1 |
| InChI | InChI=1S/C9H5ClF3NO2/c10-8-14-6-2-1-5(3-7(6)16-8)15-4-9(11,12)13/h1-3H,4H2 |
| InChIKey | OUMAPOCNFNATEA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |