C18H19FN2O2 — CID 144970947
4-[5-(3-fluoropropoxy)-1,3-benzoxazol-2-yl]-N,N-dimethylaniline (PubChem CID 144970947) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is 4-[5-(3-fluoropropoxy)-1,3-benzoxazol-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[5-(3-fluoropropoxy)-1,3-benzoxazol-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 144970947 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-[5-(3-fluoropropoxy)-1,3-benzoxazol-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nc3cc(OCCCF)ccc3o2)cc1 |
| InChI | InChI=1S/C18H19FN2O2/c1-21(2)14-6-4-13(5-7-14)18-20-16-12-15(22-11-3-10-19)8-9-17(16)23-18/h4-9,12H,3,10-11H2,1-2H3 |
| InChIKey | BPCAYVXOHODTNB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|