C19H22FN3O4 — CID 71462647
5-[5-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-1,3-benzoxazol-2-yl]-N-methylpyridin-2-amine (PubChem CID 71462647) has the molecular formula C19H22FN3O4 and a molecular weight of 375.40 g/mol. Its IUPAC name is 5-[5-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-1,3-benzoxazol-2-yl]-N-methylpyridin-2-amine.
| Compound Name | 5-[5-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-1,3-benzoxazol-2-yl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 71462647 |
| Molecular Formula | C19H22FN3O4 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 5-[5-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-1,3-benzoxazol-2-yl]-N-methylpyridin-2-amine |
| SMILES | CNc1ccc(-c2nc3cc(OCCOCCOCCF)ccc3o2)cn1 |
| InChI | InChI=1S/C19H22FN3O4/c1-21-18-5-2-14(13-22-18)19-23-16-12-15(3-4-17(16)27-19)26-11-10-25-9-8-24-7-6-20/h2-5,12-13H,6-11H2,1H3,(H,21,22) |
| InChIKey | XZOFXENTMWJTRV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|