C18H19FN2O3 — CID 122413452
(2R)-1-[[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]oxy]-3-fluoropropan-2-ol (PubChem CID 122413452) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is (2R)-1-[[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]oxy]-3-fluoropropan-2-ol.
| Compound Name | (2R)-1-[[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]oxy]-3-fluoropropan-2-ol |
|---|---|
| PubChem CID | 122413452 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (2R)-1-[[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]oxy]-3-fluoropropan-2-ol |
| SMILES | CN(C)c1ccc(-c2nc3cc(OC[C@@H](O)CF)ccc3o2)cc1 |
| InChI | InChI=1S/C18H19FN2O3/c1-21(2)13-5-3-12(4-6-13)18-20-16-9-15(7-8-17(16)24-18)23-11-14(22)10-19/h3-9,14,22H,10-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | KJOHCRRNMSTWKB-AWEZNQCLSA-N |
| XLogP | 3.27 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|