C17H18N2O — CID 91684357
4-(5-ethyl-1,3-benzoxazol-2-yl)-N,N-dimethylaniline (PubChem CID 91684357) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-(5-ethyl-1,3-benzoxazol-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(5-ethyl-1,3-benzoxazol-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 91684357 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 4-(5-ethyl-1,3-benzoxazol-2-yl)-N,N-dimethylaniline |
| SMILES | CCc1ccc2oc(-c3ccc(N(C)C)cc3)nc2c1 |
| InChI | InChI=1S/C17H18N2O/c1-4-12-5-10-16-15(11-12)18-17(20-16)13-6-8-14(9-7-13)19(2)3/h5-11H,4H2,1-3H3 |
| InChIKey | GBSOLODHNFSCMZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|