C11H14N2O — CID 170202374
5-ethyl-N,N-dimethyl-1,3-benzoxazol-2-amine (PubChem CID 170202374) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-ethyl-N,N-dimethyl-1,3-benzoxazol-2-amine.
| Compound Name | 5-ethyl-N,N-dimethyl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 170202374 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 5-ethyl-N,N-dimethyl-1,3-benzoxazol-2-amine |
| SMILES | CCc1ccc2oc(N(C)C)nc2c1 |
| InChI | InChI=1S/C11H14N2O/c1-4-8-5-6-10-9(7-8)12-11(14-10)13(2)3/h5-7H,4H2,1-3H3 |
| InChIKey | RIEWWKMCWPFZKK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |