C15H22N2O — CID 115430668
2-ethyl-2-(5-ethyl-1,3-benzoxazol-2-yl)butan-1-amine (PubChem CID 115430668) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-ethyl-2-(5-ethyl-1,3-benzoxazol-2-yl)butan-1-amine.
| Compound Name | 2-ethyl-2-(5-ethyl-1,3-benzoxazol-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 115430668 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-ethyl-2-(5-ethyl-1,3-benzoxazol-2-yl)butan-1-amine |
| SMILES | CCc1ccc2oc(C(CC)(CC)CN)nc2c1 |
| InChI | InChI=1S/C15H22N2O/c1-4-11-7-8-13-12(9-11)17-14(18-13)15(5-2,6-3)10-16/h7-9H,4-6,10,16H2,1-3H3 |
| InChIKey | JZDXCWSQCHIQEW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |