C17H25NO — CID 122642760
5-tert-butyl-2-(3-methylpentan-3-yl)-1,3-benzoxazole (PubChem CID 122642760) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 5-tert-butyl-2-(3-methylpentan-3-yl)-1,3-benzoxazole.
| Compound Name | 5-tert-butyl-2-(3-methylpentan-3-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 122642760 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 5-tert-butyl-2-(3-methylpentan-3-yl)-1,3-benzoxazole |
| SMILES | CCC(C)(CC)c1nc2cc(C(C)(C)C)ccc2o1 |
| InChI | InChI=1S/C17H25NO/c1-7-17(6,8-2)15-18-13-11-12(16(3,4)5)9-10-14(13)19-15/h9-11H,7-8H2,1-6H3 |
| InChIKey | UUFBAEQVXRMVDW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |